C17H15FN2O4S2 — CID 10548663
ethyl 1-(4-fluorophenyl)-5-(5-methylsulfonylthiophen-2-yl)pyrazole-3-carboxylate (PubChem CID 10548663) has the molecular formula C17H15FN2O4S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-5-(5-methylsulfonylthiophen-2-yl)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-5-(5-methylsulfonylthiophen-2-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 10548663 |
| Molecular Formula | C17H15FN2O4S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-5-(5-methylsulfonylthiophen-2-yl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(S(C)(=O)=O)s2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H15FN2O4S2/c1-3-24-17(21)13-10-14(15-8-9-16(25-15)26(2,22)23)20(19-13)12-6-4-11(18)5-7-12/h4-10H,3H2,1-2H3 |
| InChIKey | CSSCMITZPKTRNA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |