C11H10FN3O3S — CID 175821975
1-(4-fluorophenyl)-5-methylsulfonylpyrazole-3-carboxamide (PubChem CID 175821975) has the molecular formula C11H10FN3O3S and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methylsulfonylpyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methylsulfonylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 175821975 |
| Molecular Formula | C11H10FN3O3S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methylsulfonylpyrazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1cc(C(N)=O)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FN3O3S/c1-19(17,18)10-6-9(11(13)16)14-15(10)8-4-2-7(12)3-5-8/h2-6H,1H3,(H2,13,16) |
| InChIKey | VVWXCWZVXQCPCY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |