C11H12N4O3S — CID 82589417
5-amino-1-(3-methylsulfonylphenyl)pyrazole-3-carboxamide (PubChem CID 82589417) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 5-amino-1-(3-methylsulfonylphenyl)pyrazole-3-carboxamide.
| Compound Name | 5-amino-1-(3-methylsulfonylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 82589417 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-amino-1-(3-methylsulfonylphenyl)pyrazole-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(-n2nc(C(N)=O)cc2N)c1 |
| InChI | InChI=1S/C11H12N4O3S/c1-19(17,18)8-4-2-3-7(5-8)15-10(12)6-9(14-15)11(13)16/h2-6H,12H2,1H3,(H2,13,16) |
| InChIKey | JEOSNQOKZMLLKF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |