C11H9ClF2O — CID 105488735
1-(3-chlorophenyl)-3,3-difluorocyclobutane-1-carbaldehyde (PubChem CID 105488735) has the molecular formula C11H9ClF2O and a molecular weight of 230.64 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3-difluorocyclobutane-1-carbaldehyde.
| Compound Name | 1-(3-chlorophenyl)-3,3-difluorocyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 105488735 |
| Molecular Formula | C11H9ClF2O |
| Molecular Weight | 230.64 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3-difluorocyclobutane-1-carbaldehyde |
| SMILES | O=CC1(c2cccc(Cl)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C11H9ClF2O/c12-9-3-1-2-8(4-9)10(7-15)5-11(13,14)6-10/h1-4,7H,5-6H2 |
| InChIKey | PPOYAJXTNPJHSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|