C11H12ClF2N — CID 105490327
1-(3-chlorophenyl)-3,3-difluoro-N-methylcyclobutan-1-amine (PubChem CID 105490327) has the molecular formula C11H12ClF2N and a molecular weight of 231.67 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3-difluoro-N-methylcyclobutan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-3,3-difluoro-N-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 105490327 |
| Molecular Formula | C11H12ClF2N |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3-difluoro-N-methylcyclobutan-1-amine |
| SMILES | CNC1(c2cccc(Cl)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C11H12ClF2N/c1-15-10(6-11(13,14)7-10)8-3-2-4-9(12)5-8/h2-5,15H,6-7H2,1H3 |
| InChIKey | LESGAEMIYVQUFJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |