C20H34O6Si — CID 10548909
methyl (3aR,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate (PubChem CID 10548909) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is methyl (3aR,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate.
| Compound Name | methyl (3aR,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate |
|---|---|
| PubChem CID | 10548909 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | methyl (3aR,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OC3(CCCCC3)O[C@H]2[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6Si/c1-19(2,3)27(5,6)26-16-13(18(22)23-4)12-14-17(15(16)21)25-20(24-14)10-8-7-9-11-20/h12,14-17,21H,7-11H2,1-6H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | LXDSYKLCCCPTTF-QBPKDAKJSA-N |
| XLogP | 3.30 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|