C19H32O5SSi — CID 10549013
[(3aR,4R,5S)-4-hydroxy-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl] methanesulfonate (PubChem CID 10549013) has the molecular formula C19H32O5SSi and a molecular weight of 400.61 g/mol. Its IUPAC name is [(3aR,4R,5S)-4-hydroxy-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl] methanesulfonate.
| Compound Name | [(3aR,4R,5S)-4-hydroxy-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 10549013 |
| Molecular Formula | C19H32O5SSi |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(3aR,4R,5S)-4-hydroxy-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1-yl] methanesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O)[C@@H]2C=CC(OS(C)(=O)=O)C2=C(C)C12CC2 |
| InChI | InChI=1S/C19H32O5SSi/c1-6-26(7-2,8-3)24-18-17(20)14-9-10-15(23-25(5,21)22)16(14)13(4)19(18)11-12-19/h9-10,14-15,17-18,20H,6-8,11-12H2,1-5H3/t14-,15?,17-,18-/m1/s1 |
| InChIKey | QRJVAZAKGCOMSQ-SEGWNZTKSA-N |
| XLogP | 3.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|