C18H30O3Si — CID 10567894
(3aR,4R,5S)-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol (PubChem CID 10567894) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (3aR,4R,5S)-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol.
| Compound Name | (3aR,4R,5S)-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol |
|---|---|
| PubChem CID | 10567894 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3aR,4R,5S)-7-methyl-5-triethylsilyloxyspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](O)[C@@H]2C=CC(O)C2=C(C)C12CC2 |
| InChI | InChI=1S/C18H30O3Si/c1-5-22(6-2,7-3)21-17-16(20)13-8-9-14(19)15(13)12(4)18(17)10-11-18/h8-9,13-14,16-17,19-20H,5-7,10-11H2,1-4H3/t13-,14?,16-,17-/m1/s1 |
| InChIKey | UEDIRLCAAZWGAE-KLCSZFHISA-N |
| XLogP | 3.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|