C20H36O3Si — CID 11314171
(1S,2R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,11,11-trimethylbicyclo[4.4.1]undeca-3,8-diene-1,2-diol (PubChem CID 11314171) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (1S,2R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,11,11-trimethylbicyclo[4.4.1]undeca-3,8-diene-1,2-diol.
| Compound Name | (1S,2R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,11,11-trimethylbicyclo[4.4.1]undeca-3,8-diene-1,2-diol |
|---|---|
| PubChem CID | 11314171 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (1S,2R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,11,11-trimethylbicyclo[4.4.1]undeca-3,8-diene-1,2-diol |
| SMILES | CC1=CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CC[C@@](O)([C@@H]1O)C2(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-14-11-12-15-16(23-24(7,8)18(2,3)4)10-9-13-20(22,17(14)21)19(15,5)6/h9-11,15-17,21-22H,12-13H2,1-8H3/t15-,16-,17+,20+/m0/s1 |
| InChIKey | LQHGGSDTTNIKJC-MIALQEHNSA-N |
| XLogP | 4.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|