C18H34O2Si — CID 134941785
trans-(1R,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4,4-dimethylcyclopenten-1-yl)cyclopropan-1-ol (PubChem CID 134941785) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4,4-dimethylcyclopenten-1-yl)cyclopropan-1-ol.
| Compound Name | trans-(1R,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4,4-dimethylcyclopenten-1-yl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 134941785 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | trans-(1R,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4,4-dimethylcyclopenten-1-yl)cyclopropan-1-ol |
| SMILES | CC1(C)CC=C([C@@]2(O)C[C@H]2CCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H34O2Si/c1-16(2,3)21(6,7)20-11-9-15-13-18(15,19)14-8-10-17(4,5)12-14/h8,15,19H,9-13H2,1-7H3/t15-,18+/m1/s1 |
| InChIKey | MQOTWCCFJOKNFX-QAPCUYQASA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|