C23H42O2Si — CID 146018985
cis-(1S,2S)-1-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol (PubChem CID 146018985) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is cis-(1S,2S)-1-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol.
| Compound Name | cis-(1S,2S)-1-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 146018985 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | cis-(1S,2S)-1-(3-cyclohexa-1,4-dien-1-ylpropyl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol |
| SMILES | CC(C)[Si](OCC[C@H]1C[C@@]1(O)CCCC1=CCC=CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-18(2)26(19(3)4,20(5)6)25-16-14-22-17-23(22,24)15-10-13-21-11-8-7-9-12-21/h7-8,12,18-20,22,24H,9-11,13-17H2,1-6H3/t22-,23-/m0/s1 |
| InChIKey | RTUMBAKJIJMDQR-GOTSBHOMSA-N |
| XLogP | 6.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|