C20H38O2Si — CID 10735781
1-but-3-enyl-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylcyclohex-3-en-1-ol (PubChem CID 10735781) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 1-but-3-enyl-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylcyclohex-3-en-1-ol.
| Compound Name | 1-but-3-enyl-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10735781 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-but-3-enyl-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethylcyclohex-3-en-1-ol |
| SMILES | C=CCCC1(O)CCC=C(CCO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-9-10-14-20(21)15-11-12-17(19(20,5)6)13-16-22-23(7,8)18(2,3)4/h9,12,21H,1,10-11,13-16H2,2-8H3 |
| InChIKey | HAMFNLRGIKLFAR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|