C13H18O3 — CID 21305767
5-methoxy-7-methylspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol (PubChem CID 21305767) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 5-methoxy-7-methylspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol.
| Compound Name | 5-methoxy-7-methylspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol |
|---|---|
| PubChem CID | 21305767 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 5-methoxy-7-methylspiro[1,3a,4,5-tetrahydroindene-6,1'-cyclopropane]-1,4-diol |
| SMILES | COC1C(O)C2C=CC(O)C2=C(C)C12CC2 |
| InChI | InChI=1S/C13H18O3/c1-7-10-8(3-4-9(10)14)11(15)12(16-2)13(7)5-6-13/h3-4,8-9,11-12,14-15H,5-6H2,1-2H3 |
| InChIKey | HVTGABSHAGXULJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|