C14H24O3 — CID 11746745
(3S,3aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,6-hexahydroindene-5,6-diol (PubChem CID 11746745) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3S,3aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,6-hexahydroindene-5,6-diol.
| Compound Name | (3S,3aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,6-hexahydroindene-5,6-diol |
|---|---|
| PubChem CID | 11746745 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3S,3aS)-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-1,2,3,4,5,6-hexahydroindene-5,6-diol |
| SMILES | CC(C)(C)O[C@H]1CCC2=CC(O)C(O)C[C@@]21C |
| InChI | InChI=1S/C14H24O3/c1-13(2,3)17-12-6-5-9-7-10(15)11(16)8-14(9,12)4/h7,10-12,15-16H,5-6,8H2,1-4H3/t10?,11?,12-,14-/m0/s1 |
| InChIKey | GHOCDOCMVIUYKN-BUCSNLDVSA-N |
| XLogP | 2.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|