C12H12N2OS — CID 105491379
2-(3-methyl-4,6-dihydrothieno[3,4-d]pyrazol-1-yl)phenol (PubChem CID 105491379) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-(3-methyl-4,6-dihydrothieno[3,4-d]pyrazol-1-yl)phenol.
| Compound Name | 2-(3-methyl-4,6-dihydrothieno[3,4-d]pyrazol-1-yl)phenol |
|---|---|
| PubChem CID | 105491379 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-(3-methyl-4,6-dihydrothieno[3,4-d]pyrazol-1-yl)phenol |
| SMILES | Cc1nn(-c2ccccc2O)c2c1CSC2 |
| InChI | InChI=1S/C12H12N2OS/c1-8-9-6-16-7-11(9)14(13-8)10-4-2-3-5-12(10)15/h2-5,15H,6-7H2,1H3 |
| InChIKey | ARIXJQVHMVYMRN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |