C12H13ClN2O — CID 105498422
4-(4-chlorophenyl)-5-propan-2-yl-1,3-oxazol-2-amine (PubChem CID 105498422) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-propan-2-yl-1,3-oxazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-5-propan-2-yl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 105498422 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-(4-chlorophenyl)-5-propan-2-yl-1,3-oxazol-2-amine |
| SMILES | CC(C)c1oc(N)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O/c1-7(2)11-10(15-12(14)16-11)8-3-5-9(13)6-4-8/h3-7H,1-2H3,(H2,14,15) |
| InChIKey | VCAOKKOQQZZCOT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |