C13H17ClN2 — CID 105498590
(1-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-yl)methanamine (PubChem CID 105498590) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is (1-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-yl)methanamine.
| Compound Name | (1-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-yl)methanamine |
|---|---|
| PubChem CID | 105498590 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (1-chloro-6,7,8,9,9a,10-hexahydropyrido[1,2-a]indol-8-yl)methanamine |
| SMILES | NCC1CCN2c3cccc(Cl)c3CC2C1 |
| InChI | InChI=1S/C13H17ClN2/c14-12-2-1-3-13-11(12)7-10-6-9(8-15)4-5-16(10)13/h1-3,9-10H,4-8,15H2 |
| InChIKey | WFYMHXPPIVPGEX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |