C16H24N2O2Se2 — CID 10550777
Se-[4-(diethylcarbamoylselanyl)phenyl] N,N-diethylcarbamoselenoate (PubChem CID 10550777) has the molecular formula C16H24N2O2Se2 and a molecular weight of 434.30 g/mol. Its IUPAC name is Se-[4-(diethylcarbamoylselanyl)phenyl] N,N-diethylcarbamoselenoate.
| Compound Name | Se-[4-(diethylcarbamoylselanyl)phenyl] N,N-diethylcarbamoselenoate |
|---|---|
| PubChem CID | 10550777 |
| Molecular Formula | C16H24N2O2Se2 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | Se-[4-(diethylcarbamoylselanyl)phenyl] N,N-diethylcarbamoselenoate |
| SMILES | CCN(CC)C(=O)[Se]c1ccc([Se]C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H24N2O2Se2/c1-5-17(6-2)15(19)21-13-9-11-14(12-10-13)22-16(20)18(7-3)8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | QEWVQWFIUDOWIY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|