C27H40N2O3 — CID 10551106
3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(5S,7R)-3-methyl-1-adamantyl]acetate (PubChem CID 10551106) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(5S,7R)-3-methyl-1-adamantyl]acetate.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(5S,7R)-3-methyl-1-adamantyl]acetate |
|---|---|
| PubChem CID | 10551106 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl 2-[(5S,7R)-3-methyl-1-adamantyl]acetate |
| SMILES | COc1ccccc1N1CCN(CCCOC(=O)CC23C[C@@H]4C[C@@H](CC(C)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C27H40N2O3/c1-26-15-21-14-22(16-26)18-27(17-21,20-26)19-25(30)32-13-5-8-28-9-11-29(12-10-28)23-6-3-4-7-24(23)31-2/h3-4,6-7,21-22H,5,8-20H2,1-2H3/t21-,22+,26?,27? |
| InChIKey | NXURKWUKPYJXSL-PRSBGKBPSA-N |
| XLogP | 4.75 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|