C23H43NO9 — CID 10552609
methyl (2S)-2-[[2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl]oxyacetyl]amino]-4-methylpentanoate (PubChem CID 10552609) has the molecular formula C23H43NO9 and a molecular weight of 477.60 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl]oxyacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl]oxyacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10552609 |
| Molecular Formula | C23H43NO9 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | methyl (2S)-2-[[2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-octoxyoxan-4-yl]oxyacetyl]amino]-4-methylpentanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCC(=O)N[C@@H](CC(C)C)C(=O)OC)[C@H]1O |
| InChI | InChI=1S/C23H43NO9/c1-5-6-7-8-9-10-11-31-23-20(28)21(19(27)17(13-25)33-23)32-14-18(26)24-16(12-15(2)3)22(29)30-4/h15-17,19-21,23,25,27-28H,5-14H2,1-4H3,(H,24,26)/t16-,17+,19-,20+,21-,23+/m0/s1 |
| InChIKey | FXBAQGZIOFHSGG-RIFPNOSISA-N |
| XLogP | 0.89 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|