C27H47NO2SSi — CID 10552622
tert-butyl-[(2R)-2-[[(3,3-dimethylcyclohexen-1-yl)methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutoxy]-dimethylsilane (PubChem CID 10552622) has the molecular formula C27H47NO2SSi and a molecular weight of 477.83 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[[(3,3-dimethylcyclohexen-1-yl)methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[[(3,3-dimethylcyclohexen-1-yl)methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10552622 |
| Molecular Formula | C27H47NO2SSi |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | tert-butyl-[(2R)-2-[[(3,3-dimethylcyclohexen-1-yl)methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutoxy]-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(CC2=CC(C)(C)CCC2)=N[C@@H](CO[Si](C)(C)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C27H47NO2SSi/c1-21(2)25(19-30-32(9,10)26(4,5)6)28-31(29,24-15-13-22(3)14-16-24)20-23-12-11-17-27(7,8)18-23/h13-16,18,21,25H,11-12,17,19-20H2,1-10H3/t25-,31?/m0/s1 |
| InChIKey | PBIQHXDOORZHAD-ZGAORZAOSA-N |
| XLogP | 8.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|