C13H19NO2S — CID 134845999
(3S)-3-(4-methylphenyl)-5-propan-2-yl-1-oxa-3λ6-thia-4-azacyclohex-3-ene 3-oxide (PubChem CID 134845999) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (3S)-3-(4-methylphenyl)-5-propan-2-yl-1-oxa-3λ6-thia-4-azacyclohex-3-ene 3-oxide.
| Compound Name | (3S)-3-(4-methylphenyl)-5-propan-2-yl-1-oxa-3λ6-thia-4-azacyclohex-3-ene 3-oxide |
|---|---|
| PubChem CID | 134845999 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3S)-3-(4-methylphenyl)-5-propan-2-yl-1-oxa-3λ6-thia-4-azacyclohex-3-ene 3-oxide |
| SMILES | Cc1ccc([S@@]2(=O)=NC(C(C)C)COC2)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-10(2)13-8-16-9-17(15,14-13)12-6-4-11(3)5-7-12/h4-7,10,13H,8-9H2,1-3H3/t13?,17-/m1/s1 |
| InChIKey | WUERLPAJLAUKRX-LRHAYUFXSA-N |
| XLogP | 2.83 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |