C13H20ClNO2S — CID 134846178
2-[[chloromethyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutan-1-ol (PubChem CID 134846178) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is 2-[[chloromethyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutan-1-ol.
| Compound Name | 2-[[chloromethyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 134846178 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[[chloromethyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]-3-methylbutan-1-ol |
| SMILES | Cc1ccc([S@](=O)(CCl)=NC(CO)C(C)C)cc1 |
| InChI | InChI=1S/C13H20ClNO2S/c1-10(2)13(8-16)15-18(17,9-14)12-6-4-11(3)5-7-12/h4-7,10,13,16H,8-9H2,1-3H3/t13?,18-/m1/s1 |
| InChIKey | CDLPWJDUAHDBNU-PQJIZZRHSA-N |
| XLogP | 3.04 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|