C13H18F3NO2S — CID 22298438
3-methyl-2-[[methyl-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanylidene]amino]butan-1-ol (PubChem CID 22298438) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-methyl-2-[[methyl-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanylidene]amino]butan-1-ol.
| Compound Name | 3-methyl-2-[[methyl-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanylidene]amino]butan-1-ol |
|---|---|
| PubChem CID | 22298438 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-methyl-2-[[methyl-oxo-[4-(trifluoromethyl)phenyl]-λ6-sulfanylidene]amino]butan-1-ol |
| SMILES | CC(C)C(CO)N=S(C)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO2S/c1-9(2)12(8-18)17-20(3,19)11-6-4-10(5-7-11)13(14,15)16/h4-7,9,12,18H,8H2,1-3H3 |
| InChIKey | DZQWRMBCQCYHTO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |