C28H41Cl2N3O3 — CID 10554394
12,26-dichloro-16,19,22-triethyl-2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(24),9(14),10,12,25,27-hexaene (PubChem CID 10554394) has the molecular formula C28H41Cl2N3O3 and a molecular weight of 538.56 g/mol. Its IUPAC name is 12,26-dichloro-16,19,22-triethyl-2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(24),9(14),10,12,25,27-hexaene.
| Compound Name | 12,26-dichloro-16,19,22-triethyl-2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(24),9(14),10,12,25,27-hexaene |
|---|---|
| PubChem CID | 10554394 |
| Molecular Formula | C28H41Cl2N3O3 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 12,26-dichloro-16,19,22-triethyl-2,5,8-trioxa-16,19,22-triazatricyclo[22.4.0.09,14]octacosa-1(24),9(14),10,12,25,27-hexaene |
| SMILES | CCN1CCN(CC)Cc2cc(Cl)ccc2OCCOCCOc2ccc(Cl)cc2CN(CC)CC1 |
| InChI | InChI=1S/C28H41Cl2N3O3/c1-4-31-11-13-32(5-2)21-23-19-25(29)7-9-27(23)35-17-15-34-16-18-36-28-10-8-26(30)20-24(28)22-33(6-3)14-12-31/h7-10,19-20H,4-6,11-18,21-22H2,1-3H3 |
| InChIKey | OHMXPULUBRXTRN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |