C30H44N2O6S — CID 10554897
methyl 5-[[2-[di(propan-2-yl)amino]-2-oxoethyl]-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate (PubChem CID 10554897) has the molecular formula C30H44N2O6S and a molecular weight of 560.76 g/mol. Its IUPAC name is methyl 5-[[2-[di(propan-2-yl)amino]-2-oxoethyl]-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate.
| Compound Name | methyl 5-[[2-[di(propan-2-yl)amino]-2-oxoethyl]-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 10554897 |
| Molecular Formula | C30H44N2O6S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | methyl 5-[[2-[di(propan-2-yl)amino]-2-oxoethyl]-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoate |
| SMILES | CCCCCN(CC(=O)N(C(C)C)C(C)C)C(=O)C(CCC(=O)OC)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H44N2O6S/c1-7-8-11-18-31(20-28(33)32(22(2)3)23(4)5)30(35)26(15-17-29(34)38-6)21-39(36,37)27-16-14-24-12-9-10-13-25(24)19-27/h9-10,12-14,16,19,22-23,26H,7-8,11,15,17-18,20-21H2,1-6H3 |
| InChIKey | LUGCFSMIOOCVMB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|