C29H49NO4Sn — CID 10555448
dimethyl 6-cyano-4,4-dimethyl-6-(tributylstannylmethyl)-1,3,3a,5-tetrahydroindene-2,2-dicarboxylate (PubChem CID 10555448) has the molecular formula C29H49NO4Sn and a molecular weight of 594.43 g/mol. Its IUPAC name is dimethyl 6-cyano-4,4-dimethyl-6-(tributylstannylmethyl)-1,3,3a,5-tetrahydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-cyano-4,4-dimethyl-6-(tributylstannylmethyl)-1,3,3a,5-tetrahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10555448 |
| Molecular Formula | C29H49NO4Sn |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | dimethyl 6-cyano-4,4-dimethyl-6-(tributylstannylmethyl)-1,3,3a,5-tetrahydroindene-2,2-dicarboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC1(C#N)C=C2CC(C(=O)OC)(C(=O)OC)CC2C(C)(C)C1 |
| InChI | InChI=1S/C17H22NO4.3C4H9.Sn/c1-15(2)9-16(3,10-18)6-11-7-17(8-12(11)15,13(19)21-4)14(20)22-5;3*1-3-4-2;/h6,12H,3,7-9H2,1-2,4-5H3;3*1,3-4H2,2H3; |
| InChIKey | SVRSOCLVYNRFJT-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|