C28H31F3N6O4 — CID 10556164
5-acetyl-N-[3-[4-(2-carbamoylphenyl)piperazin-1-yl]propyl]-6-methyl-2-oxo-4-(3,4,5-trifluorophenyl)-1,4-dihydropyrimidine-3-carboxamide (PubChem CID 10556164) has the molecular formula C28H31F3N6O4 and a molecular weight of 572.59 g/mol. Its IUPAC name is 5-acetyl-N-[3-[4-(2-carbamoylphenyl)piperazin-1-yl]propyl]-6-methyl-2-oxo-4-(3,4,5-trifluorophenyl)-1,4-dihydropyrimidine-3-carboxamide.
| Compound Name | 5-acetyl-N-[3-[4-(2-carbamoylphenyl)piperazin-1-yl]propyl]-6-methyl-2-oxo-4-(3,4,5-trifluorophenyl)-1,4-dihydropyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 10556164 |
| Molecular Formula | C28H31F3N6O4 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 5-acetyl-N-[3-[4-(2-carbamoylphenyl)piperazin-1-yl]propyl]-6-methyl-2-oxo-4-(3,4,5-trifluorophenyl)-1,4-dihydropyrimidine-3-carboxamide |
| SMILES | CC(=O)C1=C(C)NC(=O)N(C(=O)NCCCN2CCN(c3ccccc3C(N)=O)CC2)C1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C28H31F3N6O4/c1-16-23(17(2)38)25(18-14-20(29)24(31)21(30)15-18)37(28(41)34-16)27(40)33-8-5-9-35-10-12-36(13-11-35)22-7-4-3-6-19(22)26(32)39/h3-4,6-7,14-15,25H,5,8-13H2,1-2H3,(H2,32,39)(H,33,40)(H,34,41) |
| InChIKey | XQFNJNZLLWMIES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|