C14H11FN2O — CID 4789050
2-(4-fluorophenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 4789050) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-(4-fluorophenyl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4789050 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(4-fluorophenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2ccc(F)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C14H11FN2O/c15-10-7-5-9(6-8-10)13-16-12-4-2-1-3-11(12)14(18)17-13/h1-8,13,16H,(H,17,18) |
| InChIKey | TVPPBWCYGUMJAW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |