C11H14N2O — CID 10559582
7-methyl-8-prop-2-enyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one (PubChem CID 10559582) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 7-methyl-8-prop-2-enyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one.
| Compound Name | 7-methyl-8-prop-2-enyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 10559582 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 7-methyl-8-prop-2-enyl-2,3-dihydro-1H-imidazo[1,2-a]pyridin-5-one |
| SMILES | C=CCc1c(C)cc(=O)n2c1NCC2 |
| InChI | InChI=1S/C11H14N2O/c1-3-4-9-8(2)7-10(14)13-6-5-12-11(9)13/h3,7,12H,1,4-6H2,2H3 |
| InChIKey | LTMWNOKERPASOE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|