C12H23N3 — CID 10560363
(3R,4R)-4-azido-3-methylundec-1-ene (PubChem CID 10560363) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (3R,4R)-4-azido-3-methylundec-1-ene.
| Compound Name | (3R,4R)-4-azido-3-methylundec-1-ene |
|---|---|
| PubChem CID | 10560363 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (3R,4R)-4-azido-3-methylundec-1-ene |
| SMILES | C=C[C@@H](C)[C@@H](CCCCCCC)N=[N+]=[N-] |
| InChI | InChI=1S/C12H23N3/c1-4-6-7-8-9-10-12(14-15-13)11(3)5-2/h5,11-12H,2,4,6-10H2,1,3H3/t11-,12-/m1/s1 |
| InChIKey | GBMGTIFTVYSNKP-VXGBXAGGSA-N |
| XLogP | 4.85 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|