C12H20O3 — CID 10560494
cyclopentyl-(2,2-dimethyl-1,3-dioxan-5-yl)methanone (PubChem CID 10560494) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is cyclopentyl-(2,2-dimethyl-1,3-dioxan-5-yl)methanone.
| Compound Name | cyclopentyl-(2,2-dimethyl-1,3-dioxan-5-yl)methanone |
|---|---|
| PubChem CID | 10560494 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cyclopentyl-(2,2-dimethyl-1,3-dioxan-5-yl)methanone |
| SMILES | CC1(C)OCC(C(=O)C2CCCC2)CO1 |
| InChI | InChI=1S/C12H20O3/c1-12(2)14-7-10(8-15-12)11(13)9-5-3-4-6-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | AMACTRLSPPTPSN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |