C12H20O4 — CID 134972642
(4R)-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentane-2,3-dione (PubChem CID 134972642) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (4R)-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentane-2,3-dione.
| Compound Name | (4R)-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentane-2,3-dione |
|---|---|
| PubChem CID | 134972642 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (4R)-4-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@H](C)[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C12H20O4/c1-7-6-15-12(4,5)16-11(7)8(2)10(14)9(3)13/h7-8,11H,6H2,1-5H3/t7-,8+,11-/m1/s1 |
| InChIKey | HBTLGFKPNLFFIN-VHSKPIJISA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|