C13H24O3 — CID 23249715
2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-methylhexan-3-one (PubChem CID 23249715) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-methylhexan-3-one.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-methylhexan-3-one |
|---|---|
| PubChem CID | 23249715 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2-methylhexan-3-one |
| SMILES | CCCC(=O)C(C)(C)C1CCOC(C)(C)O1 |
| InChI | InChI=1S/C13H24O3/c1-6-7-10(14)12(2,3)11-8-9-15-13(4,5)16-11/h11H,6-9H2,1-5H3 |
| InChIKey | QHXXWZLTJOQQNF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |