C17H30O3Si — CID 11289882
2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methyl-7-trimethylsilylhept-6-yn-3-one (PubChem CID 11289882) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methyl-7-trimethylsilylhept-6-yn-3-one.
| Compound Name | 2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methyl-7-trimethylsilylhept-6-yn-3-one |
|---|---|
| PubChem CID | 11289882 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methyl-7-trimethylsilylhept-6-yn-3-one |
| SMILES | CC1(C)OCC[C@@H](C(C)(C)C(=O)CCC#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H30O3Si/c1-16(2,15-11-12-19-17(3,4)20-15)14(18)10-8-9-13-21(5,6)7/h15H,8,10-12H2,1-7H3/t15-/m0/s1 |
| InChIKey | TZHOBEJWABSIGL-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|