C15H20O — CID 10560692
(1aS,4S,7aR,7bS)-1,1,4-trimethyl-7-methylidene-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-one (PubChem CID 10560692) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1aS,4S,7aR,7bS)-1,1,4-trimethyl-7-methylidene-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-one.
| Compound Name | (1aS,4S,7aR,7bS)-1,1,4-trimethyl-7-methylidene-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-one |
|---|---|
| PubChem CID | 10560692 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1aS,4S,7aR,7bS)-1,1,4-trimethyl-7-methylidene-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-one |
| SMILES | C=C1C(=O)C=C2[C@H]1[C@@H]1[C@H](CC[C@@H]2C)C1(C)C |
| InChI | InChI=1S/C15H20O/c1-8-5-6-11-14(15(11,3)4)13-9(2)12(16)7-10(8)13/h7-8,11,13-14H,2,5-6H2,1,3-4H3/t8-,11-,13-,14-/m0/s1 |
| InChIKey | KIXJUGBBHBKEHB-LDZXTUBUSA-N |
| XLogP | 3.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|