C11H19NO4 — CID 10561389
(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2R)-pyrrolidin-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 10561389) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2R)-pyrrolidin-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2R)-pyrrolidin-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 10561389 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(2R)-pyrrolidin-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3CCCN3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C11H19NO4/c1-11(2)15-9-7(13)8(14-10(9)16-11)6-4-3-5-12-6/h6-10,12-13H,3-5H2,1-2H3/t6-,7+,8-,9-,10-/m1/s1 |
| InChIKey | WLZZNSVCIQGGPR-JDDHQFAOSA-N |
| XLogP | -0.02 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |