C18H35NO5 — CID 5275349
3-(heptylamino)-3-[(6R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol (PubChem CID 5275349) has the molecular formula C18H35NO5 and a molecular weight of 345.48 g/mol. Its IUPAC name is 3-(heptylamino)-3-[(6R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol.
| Compound Name | 3-(heptylamino)-3-[(6R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 5275349 |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-(heptylamino)-3-[(6R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propan-1-ol |
| SMILES | CCCCCCCNC(CCO)C1OC2OC(C)(C)OC2[C@@H]1OC |
| InChI | InChI=1S/C18H35NO5/c1-5-6-7-8-9-11-19-13(10-12-20)14-15(21-4)16-17(22-14)24-18(2,3)23-16/h13-17,19-20H,5-12H2,1-4H3/t13?,14?,15-,16?,17?/m1/s1 |
| InChIKey | ZRJFMCLUHSNJSP-WALXCBACSA-N |
| XLogP | 2.19 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|