C17H29NO6 — CID 5275361
3-(cyclopropylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol (PubChem CID 5275361) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-(cyclopropylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol.
| Compound Name | 3-(cyclopropylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 5275361 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3-(cyclopropylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
| SMILES | CC1(C)OC2O[C@H](C(CCO)NC3CC3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C17H29NO6/c1-16(2)21-12-11(10(7-8-19)18-9-5-6-9)20-15-14(13(12)22-16)23-17(3,4)24-15/h9-15,18-19H,5-8H2,1-4H3/t10?,11-,12?,13?,14?,15?/m1/s1 |
| InChIKey | ZXTQDDYIFGNLKY-AOAHJRJYSA-N |
| XLogP | 0.89 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |