C20H35NO6 — CID 5275362
3-(cyclohexylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol (PubChem CID 5275362) has the molecular formula C20H35NO6 and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-(cyclohexylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol.
| Compound Name | 3-(cyclohexylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 5275362 |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 3-(cyclohexylamino)-3-[(8R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
| SMILES | CC1(C)OC2O[C@H](C(CCO)NC3CCCCC3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C20H35NO6/c1-19(2)24-15-14(13(10-11-22)21-12-8-6-5-7-9-12)23-18-17(16(15)25-19)26-20(3,4)27-18/h12-18,21-22H,5-11H2,1-4H3/t13?,14-,15?,16?,17?,18?/m1/s1 |
| InChIKey | ZFQFBMOFDFNOAI-YWTTYQRVSA-N |
| XLogP | 2.06 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |