C30H63N3O6 — CID 134135369
1-[(2S,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-di(nonoxy)oxan-2-yl]oxy-3-(3-hydroxypropylamino)propan-2-ol (PubChem CID 134135369) has the molecular formula C30H63N3O6 and a molecular weight of 561.85 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-di(nonoxy)oxan-2-yl]oxy-3-(3-hydroxypropylamino)propan-2-ol.
| Compound Name | 1-[(2S,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-di(nonoxy)oxan-2-yl]oxy-3-(3-hydroxypropylamino)propan-2-ol |
|---|---|
| PubChem CID | 134135369 |
| Molecular Formula | C30H63N3O6 |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 561.47 |
| IUPAC Name | 1-[(2S,3R,4R,5R,6R)-3-amino-6-(aminomethyl)-4,5-di(nonoxy)oxan-2-yl]oxy-3-(3-hydroxypropylamino)propan-2-ol |
| SMILES | CCCCCCCCCO[C@@H]1[C@@H](N)[C@@H](OCC(O)CNCCCO)O[C@H](CN)[C@H]1OCCCCCCCCC |
| InChI | InChI=1S/C30H63N3O6/c1-3-5-7-9-11-13-15-20-36-28-26(22-31)39-30(38-24-25(35)23-33-18-17-19-34)27(32)29(28)37-21-16-14-12-10-8-6-4-2/h25-30,33-35H,3-24,31-32H2,1-2H3/t25?,26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | HVKHLSVYTWRGQR-RRMDDZSCSA-N |
| XLogP | 3.62 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|