C12H15NO2S — CID 10561864
5-[1-(benzenesulfonyl)ethyl]-3,4-dihydro-2H-pyrrole (PubChem CID 10561864) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)ethyl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-[1-(benzenesulfonyl)ethyl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 10561864 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-[1-(benzenesulfonyl)ethyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CC(C1=NCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2S/c1-10(12-8-5-9-13-12)16(14,15)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | OVMQWIGZOSQLPU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |