About 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine
6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine (PubChem CID 12791711) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine.
Analyze 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine (CID 12791711) is 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine is CC1=NCCC(Sc2ccccc2)C1.
What is the InChIKey of 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine?
The InChIKey is SBJGIVMVCMETCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-10-9-12(7-8-13-10)14-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3.
What are the key properties of 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine?
6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine has a molecular weight of 205.33 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-phenylsulfanyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 12791711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).