C15H19NS — CID 101052267
2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole (PubChem CID 101052267) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole.
| Compound Name | 2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole |
|---|---|
| PubChem CID | 101052267 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole |
| SMILES | c1ccc(SCC2CC3CCCCC3=N2)cc1 |
| InChI | InChI=1S/C15H19NS/c1-2-7-14(8-3-1)17-11-13-10-12-6-4-5-9-15(12)16-13/h1-3,7-8,12-13H,4-6,9-11H2 |
| InChIKey | ATJSQQVULGGPFE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |