C21H23NS — CID 15359818
(3aR,5S)-5-phenyl-2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole (PubChem CID 15359818) has the molecular formula C21H23NS and a molecular weight of 321.49 g/mol. Its IUPAC name is (3aR,5S)-5-phenyl-2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole.
| Compound Name | (3aR,5S)-5-phenyl-2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole |
|---|---|
| PubChem CID | 15359818 |
| Molecular Formula | C21H23NS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (3aR,5S)-5-phenyl-2-(phenylsulfanylmethyl)-3,3a,4,5,6,7-hexahydro-2H-indole |
| SMILES | c1ccc(SCC2C[C@H]3C[C@@H](c4ccccc4)CCC3=N2)cc1 |
| InChI | InChI=1S/C21H23NS/c1-3-7-16(8-4-1)17-11-12-21-18(13-17)14-19(22-21)15-23-20-9-5-2-6-10-20/h1-10,17-19H,11-15H2/t17-,18+,19?/m0/s1 |
| InChIKey | HDKDBYGUACNZIM-PAMZHZACSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |