C31H37NS — CID 123375176
N-(3-phenylbut-3-enyl)-2-(4-phenylsulfanylphenyl)nonan-3-imine (PubChem CID 123375176) has the molecular formula C31H37NS and a molecular weight of 455.71 g/mol. Its IUPAC name is N-(3-phenylbut-3-enyl)-2-(4-phenylsulfanylphenyl)nonan-3-imine.
| Compound Name | N-(3-phenylbut-3-enyl)-2-(4-phenylsulfanylphenyl)nonan-3-imine |
|---|---|
| PubChem CID | 123375176 |
| Molecular Formula | C31H37NS |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-(3-phenylbut-3-enyl)-2-(4-phenylsulfanylphenyl)nonan-3-imine |
| SMILES | C=C(CC/N=C(\CCCCCC)C(C)c1ccc(Sc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H37NS/c1-4-5-6-13-18-31(32-24-23-25(2)27-14-9-7-10-15-27)26(3)28-19-21-30(22-20-28)33-29-16-11-8-12-17-29/h7-12,14-17,19-22,26H,2,4-6,13,18,23-24H2,1,3H3/b32-31+ |
| InChIKey | DTXRKPVETOWAPU-QNEJGDQOSA-N |
| XLogP | 9.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|