C18H17FINS — CID 143077833
(2S,3R)-2-(fluoromethyl)-3-[4-(iodomethylsulfanyl)phenyl]-5-phenyl-3,4-dihydro-2H-pyrrole (PubChem CID 143077833) has the molecular formula C18H17FINS and a molecular weight of 425.31 g/mol. Its IUPAC name is (2S,3R)-2-(fluoromethyl)-3-[4-(iodomethylsulfanyl)phenyl]-5-phenyl-3,4-dihydro-2H-pyrrole.
| Compound Name | (2S,3R)-2-(fluoromethyl)-3-[4-(iodomethylsulfanyl)phenyl]-5-phenyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 143077833 |
| Molecular Formula | C18H17FINS |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | (2S,3R)-2-(fluoromethyl)-3-[4-(iodomethylsulfanyl)phenyl]-5-phenyl-3,4-dihydro-2H-pyrrole |
| SMILES | FC[C@H]1N=C(c2ccccc2)C[C@@H]1c1ccc(SCI)cc1 |
| InChI | InChI=1S/C18H17FINS/c19-11-18-16(13-6-8-15(9-7-13)22-12-20)10-17(21-18)14-4-2-1-3-5-14/h1-9,16,18H,10-12H2/t16-,18-/m1/s1 |
| InChIKey | DZUSFQPOIVNBGN-SJLPKXTDSA-N |
| XLogP | 5.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|