C27H31NS — CID 142160712
9-[2-(2,7,8,9-tetrahydro-1H-fluoren-9-ylsulfanyl)phenyl]-3,4,5,6,7,8-hexahydro-2H-azonine (PubChem CID 142160712) has the molecular formula C27H31NS and a molecular weight of 401.62 g/mol. Its IUPAC name is 9-[2-(2,7,8,9-tetrahydro-1H-fluoren-9-ylsulfanyl)phenyl]-3,4,5,6,7,8-hexahydro-2H-azonine.
| Compound Name | 9-[2-(2,7,8,9-tetrahydro-1H-fluoren-9-ylsulfanyl)phenyl]-3,4,5,6,7,8-hexahydro-2H-azonine |
|---|---|
| PubChem CID | 142160712 |
| Molecular Formula | C27H31NS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 9-[2-(2,7,8,9-tetrahydro-1H-fluoren-9-ylsulfanyl)phenyl]-3,4,5,6,7,8-hexahydro-2H-azonine |
| SMILES | C1=CC2=C(CC1)C(Sc1ccccc1/C1=N/CCCCCCC1)C1=C2C=CCC1 |
| InChI | InChI=1S/C27H31NS/c1-2-4-17-25(28-19-11-3-1)24-16-9-10-18-26(24)29-27-22-14-7-5-12-20(22)21-13-6-8-15-23(21)27/h5-6,9-10,12-13,16,18,27H,1-4,7-8,11,14-15,17,19H2/b28-25+ |
| InChIKey | PQGFQHCZFHQMPH-AZPGRJICSA-N |
| XLogP | 7.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |