C12H12F3NS — CID 121000983
4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-benzothiazine (PubChem CID 121000983) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-benzothiazine.
| Compound Name | 4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-benzothiazine |
|---|---|
| PubChem CID | 121000983 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-benzothiazine |
| SMILES | CC(C)C1=NC(C(F)(F)F)Sc2ccccc21 |
| InChI | InChI=1S/C12H12F3NS/c1-7(2)10-8-5-3-4-6-9(8)17-11(16-10)12(13,14)15/h3-7,11H,1-2H3 |
| InChIKey | JFRRWEYBPITXIZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |