C21H20F3NS — CID 70103284
3-ethyl-5-phenyl-3-[(Z)-4,4,4-trifluorobut-1-enyl]-2H-1,4-benzothiazepine (PubChem CID 70103284) has the molecular formula C21H20F3NS and a molecular weight of 375.46 g/mol. Its IUPAC name is 3-ethyl-5-phenyl-3-[(Z)-4,4,4-trifluorobut-1-enyl]-2H-1,4-benzothiazepine.
| Compound Name | 3-ethyl-5-phenyl-3-[(Z)-4,4,4-trifluorobut-1-enyl]-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 70103284 |
| Molecular Formula | C21H20F3NS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-ethyl-5-phenyl-3-[(Z)-4,4,4-trifluorobut-1-enyl]-2H-1,4-benzothiazepine |
| SMILES | CCC1(/C=C\CC(F)(F)F)CSc2ccccc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H20F3NS/c1-2-20(13-8-14-21(22,23)24)15-26-18-12-7-6-11-17(18)19(25-20)16-9-4-3-5-10-16/h3-13H,2,14-15H2,1H3/b13-8- |
| InChIKey | DQKKOWFPYAVDLQ-JYRVWZFOSA-N |
| XLogP | 6.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|